C12H11Cl2N3O2 — CID 19270375
1-[(2,4-dichlorophenoxy)methyl]-N-methylpyrazole-3-carboxamide (PubChem CID 19270375) has the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.15 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenoxy)methyl]-N-methylpyrazole-3-carboxamide.
| Compound Name | 1-[(2,4-dichlorophenoxy)methyl]-N-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19270375 |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 1-[(2,4-dichlorophenoxy)methyl]-N-methylpyrazole-3-carboxamide |
| SMILES | CNC(=O)c1ccn(COc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C12H11Cl2N3O2/c1-15-12(18)10-4-5-17(16-10)7-19-11-3-2-8(13)6-9(11)14/h2-6H,7H2,1H3,(H,15,18) |
| InChIKey | MGOTVASAESOZCV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |