C11H10BrClN4O2 — CID 7017684
1-[(4-bromo-2-chlorophenoxy)methyl]pyrazole-3-carbohydrazide (PubChem CID 7017684) has the molecular formula C11H10BrClN4O2 and a molecular weight of 345.58 g/mol. Its IUPAC name is 1-[(4-bromo-2-chlorophenoxy)methyl]pyrazole-3-carbohydrazide.
| Compound Name | 1-[(4-bromo-2-chlorophenoxy)methyl]pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 7017684 |
| Molecular Formula | C11H10BrClN4O2 |
| Molecular Weight | 345.58 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 1-[(4-bromo-2-chlorophenoxy)methyl]pyrazole-3-carbohydrazide |
| SMILES | NNC(=O)c1ccn(COc2ccc(Br)cc2Cl)n1 |
| InChI | InChI=1S/C11H10BrClN4O2/c12-7-1-2-10(8(13)5-7)19-6-17-4-3-9(16-17)11(18)15-14/h1-5H,6,14H2,(H,15,18) |
| InChIKey | YNLDVQMWNYDZKX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.58 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|