C21H12BrClF5N5O2 — CID 19286929
1-[(4-bromo-2-chlorophenoxy)methyl]-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]pyrazole-3-carboxamide (PubChem CID 19286929) has the molecular formula C21H12BrClF5N5O2 and a molecular weight of 576.71 g/mol. Its IUPAC name is 1-[(4-bromo-2-chlorophenoxy)methyl]-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]pyrazole-3-carboxamide.
| Compound Name | 1-[(4-bromo-2-chlorophenoxy)methyl]-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19286929 |
| Molecular Formula | C21H12BrClF5N5O2 |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 574.98 |
| IUPAC Name | 1-[(4-bromo-2-chlorophenoxy)methyl]-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccn(Cc2c(F)c(F)c(F)c(F)c2F)n1)c1ccn(COc2ccc(Br)cc2Cl)n1 |
| InChI | InChI=1S/C21H12BrClF5N5O2/c22-10-1-2-14(12(23)7-10)35-9-33-5-3-13(30-33)21(34)29-15-4-6-32(31-15)8-11-16(24)18(26)20(28)19(27)17(11)25/h1-7H,8-9H2,(H,29,31,34) |
| InChIKey | WNVKBJOTFOTUNJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|