C17H12BrClN4O4 — CID 19274647
1-[(4-bromo-2-chlorophenoxy)methyl]-N-(4-nitrophenyl)pyrazole-3-carboxamide (PubChem CID 19274647) has the molecular formula C17H12BrClN4O4 and a molecular weight of 451.66 g/mol. Its IUPAC name is 1-[(4-bromo-2-chlorophenoxy)methyl]-N-(4-nitrophenyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(4-bromo-2-chlorophenoxy)methyl]-N-(4-nitrophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19274647 |
| Molecular Formula | C17H12BrClN4O4 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | 1-[(4-bromo-2-chlorophenoxy)methyl]-N-(4-nitrophenyl)pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)c1ccn(COc2ccc(Br)cc2Cl)n1 |
| InChI | InChI=1S/C17H12BrClN4O4/c18-11-1-6-16(14(19)9-11)27-10-22-8-7-15(21-22)17(24)20-12-2-4-13(5-3-12)23(25)26/h1-9H,10H2,(H,20,24) |
| InChIKey | LSDOQXUKQIZDMK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|