C24H18ClN5O8 — CID 19276826
1-[(2-chloro-4-nitrophenoxy)methyl]-N-[3-(4-methoxyphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide (PubChem CID 19276826) has the molecular formula C24H18ClN5O8 and a molecular weight of 539.89 g/mol. Its IUPAC name is 1-[(2-chloro-4-nitrophenoxy)methyl]-N-[3-(4-methoxyphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(2-chloro-4-nitrophenoxy)methyl]-N-[3-(4-methoxyphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19276826 |
| Molecular Formula | C24H18ClN5O8 |
| Molecular Weight | 539.89 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | 1-[(2-chloro-4-nitrophenoxy)methyl]-N-[3-(4-methoxyphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide |
| SMILES | COc1ccc(Oc2cc(NC(=O)c3ccn(COc4ccc([N+](=O)[O-])cc4Cl)n3)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H18ClN5O8/c1-36-18-3-5-19(6-4-18)38-20-11-15(10-17(12-20)30(34)35)26-24(31)22-8-9-28(27-22)14-37-23-7-2-16(29(32)33)13-21(23)25/h2-13H,14H2,1H3,(H,26,31) |
| InChIKey | AGMLNKGYDMAJGG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 160.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.89 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|