C18H14Cl2N4O5 — CID 19269901
1-[(2,6-dichlorophenoxy)methyl]-N-(3-methoxy-5-nitrophenyl)pyrazole-3-carboxamide (PubChem CID 19269901) has the molecular formula C18H14Cl2N4O5 and a molecular weight of 437.24 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenoxy)methyl]-N-(3-methoxy-5-nitrophenyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(2,6-dichlorophenoxy)methyl]-N-(3-methoxy-5-nitrophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19269901 |
| Molecular Formula | C18H14Cl2N4O5 |
| Molecular Weight | 437.24 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 1-[(2,6-dichlorophenoxy)methyl]-N-(3-methoxy-5-nitrophenyl)pyrazole-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccn(COc3c(Cl)cccc3Cl)n2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14Cl2N4O5/c1-28-13-8-11(7-12(9-13)24(26)27)21-18(25)16-5-6-23(22-16)10-29-17-14(19)3-2-4-15(17)20/h2-9H,10H2,1H3,(H,21,25) |
| InChIKey | FSODXYHSARFZIC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.24 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|