C24H18Cl2N4O5 — CID 19269637
1-[(2,3-dichlorophenoxy)methyl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide (PubChem CID 19269637) has the molecular formula C24H18Cl2N4O5 and a molecular weight of 513.34 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenoxy)methyl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(2,3-dichlorophenoxy)methyl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19269637 |
| Molecular Formula | C24H18Cl2N4O5 |
| Molecular Weight | 513.34 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | 1-[(2,3-dichlorophenoxy)methyl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide |
| SMILES | Cc1cccc(Oc2cc(NC(=O)c3ccn(COc4cccc(Cl)c4Cl)n3)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C24H18Cl2N4O5/c1-15-4-2-5-18(10-15)35-19-12-16(11-17(13-19)30(32)33)27-24(31)21-8-9-29(28-21)14-34-22-7-3-6-20(25)23(22)26/h2-13H,14H2,1H3,(H,27,31) |
| InChIKey | NRHQQIHFUAXERJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.34 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|