C24H17Cl3N4O5 — CID 19270068
N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-1-[(2,6-dichlorophenoxy)methyl]pyrazole-3-carboxamide (PubChem CID 19270068) has the molecular formula C24H17Cl3N4O5 and a molecular weight of 547.78 g/mol. Its IUPAC name is N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-1-[(2,6-dichlorophenoxy)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-1-[(2,6-dichlorophenoxy)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19270068 |
| Molecular Formula | C24H17Cl3N4O5 |
| Molecular Weight | 547.78 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-1-[(2,6-dichlorophenoxy)methyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(Cl)ccc1Oc1cc(NC(=O)c2ccn(COc3c(Cl)cccc3Cl)n2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H17Cl3N4O5/c1-14-9-15(25)5-6-22(14)36-18-11-16(10-17(12-18)31(33)34)28-24(32)21-7-8-30(29-21)13-35-23-19(26)3-2-4-20(23)27/h2-12H,13H2,1H3,(H,28,32) |
| InChIKey | QETZREMVWVIJNQ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.78 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|