C28H27ClN4O5 — CID 19273890
1-[(4-tert-butylphenoxy)methyl]-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide (PubChem CID 19273890) has the molecular formula C28H27ClN4O5 and a molecular weight of 535.00 g/mol. Its IUPAC name is 1-[(4-tert-butylphenoxy)methyl]-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(4-tert-butylphenoxy)methyl]-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19273890 |
| Molecular Formula | C28H27ClN4O5 |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 1-[(4-tert-butylphenoxy)methyl]-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(Cl)ccc1Oc1cc(NC(=O)c2ccn(COc3ccc(C(C)(C)C)cc3)n2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H27ClN4O5/c1-18-13-20(29)7-10-26(18)38-24-15-21(14-22(16-24)33(35)36)30-27(34)25-11-12-32(31-25)17-37-23-8-5-19(6-9-23)28(2,3)4/h5-16H,17H2,1-4H3,(H,30,34) |
| InChIKey | ZXQOSEPXHFCTPQ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|