C24H18BrClN4O5 — CID 19274482
1-[(2-bromo-4-chlorophenoxy)methyl]-N-[3-(2-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide (PubChem CID 19274482) has the molecular formula C24H18BrClN4O5 and a molecular weight of 557.79 g/mol. Its IUPAC name is 1-[(2-bromo-4-chlorophenoxy)methyl]-N-[3-(2-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(2-bromo-4-chlorophenoxy)methyl]-N-[3-(2-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19274482 |
| Molecular Formula | C24H18BrClN4O5 |
| Molecular Weight | 557.79 g/mol |
| Exact Mass | 556.01 |
| IUPAC Name | 1-[(2-bromo-4-chlorophenoxy)methyl]-N-[3-(2-methylphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide |
| SMILES | Cc1ccccc1Oc1cc(NC(=O)c2ccn(COc3ccc(Cl)cc3Br)n2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H18BrClN4O5/c1-15-4-2-3-5-22(15)35-19-12-17(11-18(13-19)30(32)33)27-24(31)21-8-9-29(28-21)14-34-23-7-6-16(26)10-20(23)25/h2-13H,14H2,1H3,(H,27,31) |
| InChIKey | MFMQKMWFLRIROE-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.79 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|