C23H20ClN7O6 — CID 19265031
N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19265031) has the molecular formula C23H20ClN7O6 and a molecular weight of 525.91 g/mol. Its IUPAC name is N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19265031 |
| Molecular Formula | C23H20ClN7O6 |
| Molecular Weight | 525.91 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(Cl)ccc1Oc1cc(NC(=O)c2ccn(Cn3nc(C)c([N+](=O)[O-])c3C)n2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20ClN7O6/c1-13-8-16(24)4-5-21(13)37-19-10-17(9-18(11-19)30(33)34)25-23(32)20-6-7-28(27-20)12-29-15(3)22(31(35)36)14(2)26-29/h4-11H,12H2,1-3H3,(H,25,32) |
| InChIKey | UTKVIWJVUIDSBW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 160.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.91 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|