C23H21BrN6O5 — CID 19264390
1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide (PubChem CID 19264390) has the molecular formula C23H21BrN6O5 and a molecular weight of 541.36 g/mol. Its IUPAC name is 1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19264390 |
| Molecular Formula | C23H21BrN6O5 |
| Molecular Weight | 541.36 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | 1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]pyrazole-3-carboxamide |
| SMILES | COc1ccccc1Oc1cc(NC(=O)c2ccn(Cn3nc(C)c(Br)c3C)n2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H21BrN6O5/c1-14-22(24)15(2)29(26-14)13-28-9-8-19(27-28)23(31)25-16-10-17(30(32)33)12-18(11-16)35-21-7-5-4-6-20(21)34-3/h4-12H,13H2,1-3H3,(H,25,31) |
| InChIKey | QRTOJTOIHSPPSD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|