C19H14Cl2N4O6 — CID 19506584
3-[3-[[3-(2,4-dichlorophenoxy)-5-nitrophenyl]carbamoyl]pyrazol-1-yl]propanoic acid (PubChem CID 19506584) has the molecular formula C19H14Cl2N4O6 and a molecular weight of 465.25 g/mol. Its IUPAC name is 3-[3-[[3-(2,4-dichlorophenoxy)-5-nitrophenyl]carbamoyl]pyrazol-1-yl]propanoic acid.
| Compound Name | 3-[3-[[3-(2,4-dichlorophenoxy)-5-nitrophenyl]carbamoyl]pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 19506584 |
| Molecular Formula | C19H14Cl2N4O6 |
| Molecular Weight | 465.25 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | 3-[3-[[3-(2,4-dichlorophenoxy)-5-nitrophenyl]carbamoyl]pyrazol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1ccc(C(=O)Nc2cc(Oc3ccc(Cl)cc3Cl)cc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C19H14Cl2N4O6/c20-11-1-2-17(15(21)7-11)31-14-9-12(8-13(10-14)25(29)30)22-19(28)16-3-5-24(23-16)6-4-18(26)27/h1-3,5,7-10H,4,6H2,(H,22,28)(H,26,27) |
| InChIKey | FCAOKJUKXJQHIV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.25 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|