C20H16Cl2N4O6 — CID 19267089
ethyl 3-[[3-(2,4-dichlorophenoxy)-5-nitrophenyl]carbamoyl]-1-methylpyrazole-5-carboxylate (PubChem CID 19267089) has the molecular formula C20H16Cl2N4O6 and a molecular weight of 479.28 g/mol. Its IUPAC name is ethyl 3-[[3-(2,4-dichlorophenoxy)-5-nitrophenyl]carbamoyl]-1-methylpyrazole-5-carboxylate.
| Compound Name | ethyl 3-[[3-(2,4-dichlorophenoxy)-5-nitrophenyl]carbamoyl]-1-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 19267089 |
| Molecular Formula | C20H16Cl2N4O6 |
| Molecular Weight | 479.28 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | ethyl 3-[[3-(2,4-dichlorophenoxy)-5-nitrophenyl]carbamoyl]-1-methylpyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)Nc2cc(Oc3ccc(Cl)cc3Cl)cc([N+](=O)[O-])c2)nn1C |
| InChI | InChI=1S/C20H16Cl2N4O6/c1-3-31-20(28)17-10-16(24-25(17)2)19(27)23-12-7-13(26(29)30)9-14(8-12)32-18-5-4-11(21)6-15(18)22/h4-10H,3H2,1-2H3,(H,23,27) |
| InChIKey | UEDPRLTWLCXTJG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.28 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|