C24H18Cl2N4O4 — CID 19477603
N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide (PubChem CID 19477603) has the molecular formula C24H18Cl2N4O4 and a molecular weight of 497.34 g/mol. Its IUPAC name is N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19477603 |
| Molecular Formula | C24H18Cl2N4O4 |
| Molecular Weight | 497.34 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-3,5-dimethyl-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)Nc1cc(Oc2ccc(Cl)cc2Cl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H18Cl2N4O4/c1-14-23(15(2)29(28-14)18-6-4-3-5-7-18)24(31)27-17-11-19(30(32)33)13-20(12-17)34-22-9-8-16(25)10-21(22)26/h3-13H,1-2H3,(H,27,31) |
| InChIKey | VJZYBUGCZNWMIJ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.34 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|