C20H14Cl3F3N4O4 — CID 19554204
3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]propanamide (PubChem CID 19554204) has the molecular formula C20H14Cl3F3N4O4 and a molecular weight of 537.71 g/mol. Its IUPAC name is 3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]propanamide.
| Compound Name | 3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]propanamide |
|---|---|
| PubChem CID | 19554204 |
| Molecular Formula | C20H14Cl3F3N4O4 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 536.00 |
| IUPAC Name | 3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]propanamide |
| SMILES | Cc1c(Cl)c(C(F)(F)F)nn1CCC(=O)Nc1cc(Oc2ccc(Cl)cc2Cl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H14Cl3F3N4O4/c1-10-18(23)19(20(24,25)26)28-29(10)5-4-17(31)27-12-7-13(30(32)33)9-14(8-12)34-16-3-2-11(21)6-15(16)22/h2-3,6-9H,4-5H2,1H3,(H,27,31) |
| InChIKey | DLVFUVWLCRYKBC-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|