C23H22BrF3N4O4 — CID 19550250
3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide (PubChem CID 19550250) has the molecular formula C23H22BrF3N4O4 and a molecular weight of 555.35 g/mol. Its IUPAC name is 3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide.
| Compound Name | 3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 19550250 |
| Molecular Formula | C23H22BrF3N4O4 |
| Molecular Weight | 555.35 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | 3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide |
| SMILES | Cc1cc(C)c(C)c(Oc2cc(NC(=O)CCn3nc(C(F)(F)F)c(Br)c3C)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C23H22BrF3N4O4/c1-12-7-13(2)14(3)19(8-12)35-18-10-16(9-17(11-18)31(33)34)28-20(32)5-6-30-15(4)21(24)22(29-30)23(25,26)27/h7-11H,5-6H2,1-4H3,(H,28,32) |
| InChIKey | HOOVRTUINZEQEC-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.35 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|