C23H23F3N4O4 — CID 19563604
3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide (PubChem CID 19563604) has the molecular formula C23H23F3N4O4 and a molecular weight of 476.46 g/mol. Its IUPAC name is 3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide.
| Compound Name | 3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 19563604 |
| Molecular Formula | C23H23F3N4O4 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide |
| SMILES | Cc1cc(C)c(C)c(Oc2cc(NC(=O)CCn3nc(C(F)(F)F)cc3C)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C23H23F3N4O4/c1-13-7-14(2)16(4)20(8-13)34-19-11-17(10-18(12-19)30(32)33)27-22(31)5-6-29-15(3)9-21(28-29)23(24,25)26/h7-12H,5-6H2,1-4H3,(H,27,31) |
| InChIKey | RMDNSFVJLIHLTO-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|