C20H19N5O6 — CID 19541820
3-(5-methyl-3-nitropyrazol-1-yl)-N-[3-(2-methylphenoxy)-5-nitrophenyl]propanamide (PubChem CID 19541820) has the molecular formula C20H19N5O6 and a molecular weight of 425.40 g/mol. Its IUPAC name is 3-(5-methyl-3-nitropyrazol-1-yl)-N-[3-(2-methylphenoxy)-5-nitrophenyl]propanamide.
| Compound Name | 3-(5-methyl-3-nitropyrazol-1-yl)-N-[3-(2-methylphenoxy)-5-nitrophenyl]propanamide |
|---|---|
| PubChem CID | 19541820 |
| Molecular Formula | C20H19N5O6 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 3-(5-methyl-3-nitropyrazol-1-yl)-N-[3-(2-methylphenoxy)-5-nitrophenyl]propanamide |
| SMILES | Cc1ccccc1Oc1cc(NC(=O)CCn2nc([N+](=O)[O-])cc2C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19N5O6/c1-13-5-3-4-6-18(13)31-17-11-15(10-16(12-17)24(27)28)21-20(26)7-8-23-14(2)9-19(22-23)25(29)30/h3-6,9-12H,7-8H2,1-2H3,(H,21,26) |
| InChIKey | GYWKYFFGNAKRRH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|