C21H21ClN4O4 — CID 19521033
2-(4-chloro-3-methylpyrazol-1-yl)-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]acetamide (PubChem CID 19521033) has the molecular formula C21H21ClN4O4 and a molecular weight of 428.88 g/mol. Its IUPAC name is 2-(4-chloro-3-methylpyrazol-1-yl)-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]acetamide.
| Compound Name | 2-(4-chloro-3-methylpyrazol-1-yl)-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 19521033 |
| Molecular Formula | C21H21ClN4O4 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-(4-chloro-3-methylpyrazol-1-yl)-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]acetamide |
| SMILES | Cc1cc(C)c(C)c(Oc2cc(NC(=O)Cn3cc(Cl)c(C)n3)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C21H21ClN4O4/c1-12-5-13(2)14(3)20(6-12)30-18-8-16(7-17(9-18)26(28)29)23-21(27)11-25-10-19(22)15(4)24-25/h5-10H,11H2,1-4H3,(H,23,27) |
| InChIKey | YFOLMPKVHIUDFC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|