C24H27ClN4O4 — CID 19568585
3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-methyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide (PubChem CID 19568585) has the molecular formula C24H27ClN4O4 and a molecular weight of 470.96 g/mol. Its IUPAC name is 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-methyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide.
| Compound Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-methyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 19568585 |
| Molecular Formula | C24H27ClN4O4 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-methyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide |
| SMILES | Cc1cc(C)c(C)c(Oc2cc(NC(=O)C(C)Cn3nc(C)c(Cl)c3C)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C24H27ClN4O4/c1-13-7-14(2)16(4)22(8-13)33-21-10-19(9-20(11-21)29(31)32)26-24(30)15(3)12-28-18(6)23(25)17(5)27-28/h7-11,15H,12H2,1-6H3,(H,26,30) |
| InChIKey | LGFFYFHVNVEZNR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|