C23H25N5O6 — CID 19528541
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide (PubChem CID 19528541) has the molecular formula C23H25N5O6 and a molecular weight of 467.48 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 19528541 |
| Molecular Formula | C23H25N5O6 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]propanamide |
| SMILES | Cc1cc(C)c(C)c(Oc2cc(NC(=O)C(C)n3nc(C)c([N+](=O)[O-])c3C)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C23H25N5O6/c1-12-7-13(2)14(3)21(8-12)34-20-10-18(9-19(11-20)27(30)31)24-23(29)17(6)26-16(5)22(28(32)33)15(4)25-26/h7-11,17H,1-6H3,(H,24,29) |
| InChIKey | FXPJEFHMBCWSQF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|