C20H20N4O4 — CID 19475620
2-methyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide (PubChem CID 19475620) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-methyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide.
| Compound Name | 2-methyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19475620 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-methyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C)c(C)c(Oc2cc(NC(=O)c3ccnn3C)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C20H20N4O4/c1-12-7-13(2)14(3)19(8-12)28-17-10-15(9-16(11-17)24(26)27)22-20(25)18-5-6-21-23(18)4/h5-11H,1-4H3,(H,22,25) |
| InChIKey | CQKQYXILGOKWQW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|