C21H21BrN4O4 — CID 19266210
4-bromo-1,5-dimethyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide (PubChem CID 19266210) has the molecular formula C21H21BrN4O4 and a molecular weight of 473.33 g/mol. Its IUPAC name is 4-bromo-1,5-dimethyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide.
| Compound Name | 4-bromo-1,5-dimethyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19266210 |
| Molecular Formula | C21H21BrN4O4 |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 4-bromo-1,5-dimethyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C)c(C)c(Oc2cc(NC(=O)c3nn(C)c(C)c3Br)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C21H21BrN4O4/c1-11-6-12(2)13(3)18(7-11)30-17-9-15(8-16(10-17)26(28)29)23-21(27)20-19(22)14(4)25(5)24-20/h6-10H,1-5H3,(H,23,27) |
| InChIKey | QMVGJYLAFHPEGU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|