C13H12F2N4O4 — CID 19475634
N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-methylpyrazole-3-carboxamide (PubChem CID 19475634) has the molecular formula C13H12F2N4O4 and a molecular weight of 326.26 g/mol. Its IUPAC name is N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19475634 |
| Molecular Formula | C13H12F2N4O4 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-methylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)Nc1cc(OCC(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H12F2N4O4/c1-18-11(2-3-16-18)13(20)17-8-4-9(19(21)22)6-10(5-8)23-7-12(14)15/h2-6,12H,7H2,1H3,(H,17,20) |
| InChIKey | KRQAGUUGEOCBSO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|