C12H8ClF2N5O6 — CID 135803634
4-chloro-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-5-nitro-1H-pyrazole-3-carboxamide (PubChem CID 135803634) has the molecular formula C12H8ClF2N5O6 and a molecular weight of 391.67 g/mol. Its IUPAC name is 4-chloro-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-5-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | 4-chloro-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-5-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135803634 |
| Molecular Formula | C12H8ClF2N5O6 |
| Molecular Weight | 391.67 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 4-chloro-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-5-nitro-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1cc(OCC(F)F)cc([N+](=O)[O-])c1)c1n[nH]c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C12H8ClF2N5O6/c13-9-10(17-18-11(9)20(24)25)12(21)16-5-1-6(19(22)23)3-7(2-5)26-4-8(14)15/h1-3,8H,4H2,(H,16,21)(H,17,18) |
| InChIKey | DDWQAGJIALKFPN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 153.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.67 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|