C11H6ClF3N4O4 — CID 135803539
4-chloro-5-nitro-N-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-3-carboxamide (PubChem CID 135803539) has the molecular formula C11H6ClF3N4O4 and a molecular weight of 350.64 g/mol. Its IUPAC name is 4-chloro-5-nitro-N-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 4-chloro-5-nitro-N-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135803539 |
| Molecular Formula | C11H6ClF3N4O4 |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 4-chloro-5-nitro-N-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1n[nH]c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C11H6ClF3N4O4/c12-7-8(17-18-9(7)19(21)22)10(20)16-5-1-3-6(4-2-5)23-11(13,14)15/h1-4H,(H,16,20)(H,17,18) |
| InChIKey | XKPAIQFHYAKYCF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|