C4H4ClN5O3 — CID 135645599
4-chloro-5-nitro-1H-pyrazole-3-carbohydrazide (PubChem CID 135645599) has the molecular formula C4H4ClN5O3 and a molecular weight of 205.56 g/mol. Its IUPAC name is 4-chloro-5-nitro-1H-pyrazole-3-carbohydrazide.
| Compound Name | 4-chloro-5-nitro-1H-pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 135645599 |
| Molecular Formula | C4H4ClN5O3 |
| Molecular Weight | 205.56 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | 4-chloro-5-nitro-1H-pyrazole-3-carbohydrazide |
| SMILES | NNC(=O)c1n[nH]c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C4H4ClN5O3/c5-1-2(4(11)7-6)8-9-3(1)10(12)13/h6H2,(H,7,11)(H,8,9) |
| InChIKey | CBXSYLDEWJXSDA-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.56 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|