C9H5BrClN5O3 — CID 135803518
N-(5-bromo-2-pyridinyl)-4-chloro-5-nitro-1H-pyrazole-3-carboxamide (PubChem CID 135803518) has the molecular formula C9H5BrClN5O3 and a molecular weight of 346.53 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-4-chloro-5-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-4-chloro-5-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135803518 |
| Molecular Formula | C9H5BrClN5O3 |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 344.93 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-4-chloro-5-nitro-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cn1)c1n[nH]c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C9H5BrClN5O3/c10-4-1-2-5(12-3-4)13-9(17)7-6(11)8(15-14-7)16(18)19/h1-3H,(H,14,15)(H,12,13,17) |
| InChIKey | YVWHMARWDVFOQB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|