C13H8ClN5O3 — CID 10358473
5-chloro-N-(5-nitro-2-pyridinyl)-1H-indazole-3-carboxamide (PubChem CID 10358473) has the molecular formula C13H8ClN5O3 and a molecular weight of 317.69 g/mol. Its IUPAC name is 5-chloro-N-(5-nitro-2-pyridinyl)-1H-indazole-3-carboxamide.
| Compound Name | 5-chloro-N-(5-nitro-2-pyridinyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 10358473 |
| Molecular Formula | C13H8ClN5O3 |
| Molecular Weight | 317.69 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 5-chloro-N-(5-nitro-2-pyridinyl)-1H-indazole-3-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cn1)c1n[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C13H8ClN5O3/c14-7-1-3-10-9(5-7)12(18-17-10)13(20)16-11-4-2-8(6-15-11)19(21)22/h1-6H,(H,17,18)(H,15,16,20) |
| InChIKey | GDRQXYBRYFPZFP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.69 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|