C13H8Cl2N4O — CID 11449640
5-chloro-N-(6-chloro-3-pyridinyl)-1H-indazole-3-carboxamide (PubChem CID 11449640) has the molecular formula C13H8Cl2N4O and a molecular weight of 307.14 g/mol. Its IUPAC name is 5-chloro-N-(6-chloro-3-pyridinyl)-1H-indazole-3-carboxamide.
| Compound Name | 5-chloro-N-(6-chloro-3-pyridinyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 11449640 |
| Molecular Formula | C13H8Cl2N4O |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 5-chloro-N-(6-chloro-3-pyridinyl)-1H-indazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)nc1)c1n[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C13H8Cl2N4O/c14-7-1-3-10-9(5-7)12(19-18-10)13(20)17-8-2-4-11(15)16-6-8/h1-6H,(H,17,20)(H,18,19) |
| InChIKey | ZZWGARNFJDAFDD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|