C15H10ClN7O — CID 10404956
5-chloro-N-[4-(2H-tetrazol-5-yl)phenyl]-1H-indazole-3-carboxamide (PubChem CID 10404956) has the molecular formula C15H10ClN7O and a molecular weight of 339.75 g/mol. Its IUPAC name is 5-chloro-N-[4-(2H-tetrazol-5-yl)phenyl]-1H-indazole-3-carboxamide.
| Compound Name | 5-chloro-N-[4-(2H-tetrazol-5-yl)phenyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 10404956 |
| Molecular Formula | C15H10ClN7O |
| Molecular Weight | 339.75 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 5-chloro-N-[4-(2H-tetrazol-5-yl)phenyl]-1H-indazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nn[nH]n2)cc1)c1n[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H10ClN7O/c16-9-3-6-12-11(7-9)13(19-18-12)15(24)17-10-4-1-8(2-5-10)14-20-22-23-21-14/h1-7H,(H,17,24)(H,18,19)(H,20,21,22,23) |
| InChIKey | JPZIPNGGNZWFPJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.75 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |