C14H10F2N4O — CID 60905598
5-amino-N-(3,4-difluorophenyl)-1H-indazole-3-carboxamide (PubChem CID 60905598) has the molecular formula C14H10F2N4O and a molecular weight of 288.26 g/mol. Its IUPAC name is 5-amino-N-(3,4-difluorophenyl)-1H-indazole-3-carboxamide.
| Compound Name | 5-amino-N-(3,4-difluorophenyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 60905598 |
| Molecular Formula | C14H10F2N4O |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 5-amino-N-(3,4-difluorophenyl)-1H-indazole-3-carboxamide |
| SMILES | Nc1ccc2[nH]nc(C(=O)Nc3ccc(F)c(F)c3)c2c1 |
| InChI | InChI=1S/C14H10F2N4O/c15-10-3-2-8(6-11(10)16)18-14(21)13-9-5-7(17)1-4-12(9)19-20-13/h1-6H,17H2,(H,18,21)(H,19,20) |
| InChIKey | CJUOYQXXPQJZBW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|