C15H10FN3O3 — CID 170858296
2-fluoro-5-(1H-indazole-3-carbonylamino)benzoic acid (PubChem CID 170858296) has the molecular formula C15H10FN3O3 and a molecular weight of 299.26 g/mol. Its IUPAC name is 2-fluoro-5-(1H-indazole-3-carbonylamino)benzoic acid.
| Compound Name | 2-fluoro-5-(1H-indazole-3-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 170858296 |
| Molecular Formula | C15H10FN3O3 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-fluoro-5-(1H-indazole-3-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2n[nH]c3ccccc23)ccc1F |
| InChI | InChI=1S/C15H10FN3O3/c16-11-6-5-8(7-10(11)15(21)22)17-14(20)13-9-3-1-2-4-12(9)18-19-13/h1-7H,(H,17,20)(H,18,19)(H,21,22) |
| InChIKey | YFILUBJNRXKKSH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |