C15H12BrN3O — CID 9069923
N-(4-bromo-3-methylphenyl)-1H-indazole-3-carboxamide (PubChem CID 9069923) has the molecular formula C15H12BrN3O and a molecular weight of 330.19 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-1H-indazole-3-carboxamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 9069923 |
| Molecular Formula | C15H12BrN3O |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-1H-indazole-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2n[nH]c3ccccc23)ccc1Br |
| InChI | InChI=1S/C15H12BrN3O/c1-9-8-10(6-7-12(9)16)17-15(20)14-11-4-2-3-5-13(11)18-19-14/h2-8H,1H3,(H,17,20)(H,18,19) |
| InChIKey | HEASCCWOFFVOSM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |