C16H13N3O2 — CID 38588569
N-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazole-3-carboxamide (PubChem CID 38588569) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazole-3-carboxamide.
| Compound Name | N-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 38588569 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-5-yl)-1H-indazole-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCO2)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C16H13N3O2/c20-16(15-12-3-1-2-4-13(12)18-19-15)17-11-5-6-14-10(9-11)7-8-21-14/h1-6,9H,7-8H2,(H,17,20)(H,18,19) |
| InChIKey | UDUQVJXXKADAEA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |