C14H11FN2O2 — CID 115497334
N-(2,3-dihydro-1-benzofuran-5-yl)-6-fluoropyridine-2-carboxamide (PubChem CID 115497334) has the molecular formula C14H11FN2O2 and a molecular weight of 258.25 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-5-yl)-6-fluoropyridine-2-carboxamide.
| Compound Name | N-(2,3-dihydro-1-benzofuran-5-yl)-6-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 115497334 |
| Molecular Formula | C14H11FN2O2 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-5-yl)-6-fluoropyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCO2)c1cccc(F)n1 |
| InChI | InChI=1S/C14H11FN2O2/c15-13-3-1-2-11(17-13)14(18)16-10-4-5-12-9(8-10)6-7-19-12/h1-5,8H,6-7H2,(H,16,18) |
| InChIKey | DTGYOEYKWIBQDX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|