C14H10ClFN2O3 — CID 115497158
N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-6-fluoropyridine-2-carboxamide (PubChem CID 115497158) has the molecular formula C14H10ClFN2O3 and a molecular weight of 308.70 g/mol. Its IUPAC name is N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-6-fluoropyridine-2-carboxamide.
| Compound Name | N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-6-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 115497158 |
| Molecular Formula | C14H10ClFN2O3 |
| Molecular Weight | 308.70 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-6-fluoropyridine-2-carboxamide |
| SMILES | O=C(Nc1cc2c(cc1Cl)OCCO2)c1cccc(F)n1 |
| InChI | InChI=1S/C14H10ClFN2O3/c15-8-6-11-12(21-5-4-20-11)7-10(8)18-14(19)9-2-1-3-13(16)17-9/h1-3,6-7H,4-5H2,(H,18,19) |
| InChIKey | MXKPZKNZPRNXKT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.70 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|