C19H18Cl2N4O3S — CID 167901586
5-chloro-N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-1H-indazole-3-carboxamide (PubChem CID 167901586) has the molecular formula C19H18Cl2N4O3S and a molecular weight of 453.35 g/mol. Its IUPAC name is 5-chloro-N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-1H-indazole-3-carboxamide.
| Compound Name | 5-chloro-N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 167901586 |
| Molecular Formula | C19H18Cl2N4O3S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 5-chloro-N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-1H-indazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1)c1n[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H18Cl2N4O3S/c20-12-4-7-16-14(10-12)18(24-23-16)19(26)22-13-5-6-15(21)17(11-13)29(27,28)25-8-2-1-3-9-25/h4-7,10-11H,1-3,8-9H2,(H,22,26)(H,23,24) |
| InChIKey | MBOHOJYFCLJKKL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |