C16H17ClN2O3S2 — CID 4882272
N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-3-methylthiophene-2-carboxamide (PubChem CID 4882272) has the molecular formula C16H17ClN2O3S2 and a molecular weight of 384.91 g/mol. Its IUPAC name is N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-3-methylthiophene-2-carboxamide.
| Compound Name | N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 4882272 |
| Molecular Formula | C16H17ClN2O3S2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)Nc1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C16H17ClN2O3S2/c1-11-6-9-23-15(11)16(20)18-12-4-5-13(17)14(10-12)24(21,22)19-7-2-3-8-19/h4-6,9-10H,2-3,7-8H2,1H3,(H,18,20) |
| InChIKey | WOYBOSJQCLADDH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |