C20H25N3O5S3 — CID 55464525
3-piperidin-1-ylsulfonyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)thiophene-2-carboxamide (PubChem CID 55464525) has the molecular formula C20H25N3O5S3 and a molecular weight of 483.64 g/mol. Its IUPAC name is 3-piperidin-1-ylsulfonyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)thiophene-2-carboxamide.
| Compound Name | 3-piperidin-1-ylsulfonyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55464525 |
| Molecular Formula | C20H25N3O5S3 |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 3-piperidin-1-ylsulfonyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCC2)cc1)c1sccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H25N3O5S3/c24-20(19-18(10-15-29-19)31(27,28)23-11-2-1-3-12-23)21-16-6-8-17(9-7-16)30(25,26)22-13-4-5-14-22/h6-10,15H,1-5,11-14H2,(H,21,24) |
| InChIKey | BLSAPVHHYGVPGW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |