C16H16F2N2O3S2 — CID 46665731
N-(2,5-difluorophenyl)-3-piperidin-1-ylsulfonylthiophene-2-carboxamide (PubChem CID 46665731) has the molecular formula C16H16F2N2O3S2 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-3-piperidin-1-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-(2,5-difluorophenyl)-3-piperidin-1-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 46665731 |
| Molecular Formula | C16H16F2N2O3S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-(2,5-difluorophenyl)-3-piperidin-1-ylsulfonylthiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(F)ccc1F)c1sccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H16F2N2O3S2/c17-11-4-5-12(18)13(10-11)19-16(21)15-14(6-9-24-15)25(22,23)20-7-2-1-3-8-20/h4-6,9-10H,1-3,7-8H2,(H,19,21) |
| InChIKey | GGXITNMVIVSOOY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |