C20H21N5O4S2 — CID 55495024
3-phenyl-N'-(3-piperidin-1-ylsulfonylthiophene-2-carbonyl)-1H-pyrazole-5-carbohydrazide (PubChem CID 55495024) has the molecular formula C20H21N5O4S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 3-phenyl-N'-(3-piperidin-1-ylsulfonylthiophene-2-carbonyl)-1H-pyrazole-5-carbohydrazide.
| Compound Name | 3-phenyl-N'-(3-piperidin-1-ylsulfonylthiophene-2-carbonyl)-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 55495024 |
| Molecular Formula | C20H21N5O4S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 3-phenyl-N'-(3-piperidin-1-ylsulfonylthiophene-2-carbonyl)-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1sccc1S(=O)(=O)N1CCCCC1)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C20H21N5O4S2/c26-19(16-13-15(21-22-16)14-7-3-1-4-8-14)23-24-20(27)18-17(9-12-30-18)31(28,29)25-10-5-2-6-11-25/h1,3-4,7-9,12-13H,2,5-6,10-11H2,(H,21,22)(H,23,26)(H,24,27) |
| InChIKey | JMMDTTGKXPQIKT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|