C14H23N3O3S2 — CID 134037246
N-[3-(dimethylamino)propyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide (PubChem CID 134037246) has the molecular formula C14H23N3O3S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 134037246 |
| Molecular Formula | C14H23N3O3S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1sccc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C14H23N3O3S2/c1-16(2)8-5-7-15-14(18)13-12(6-11-21-13)22(19,20)17-9-3-4-10-17/h6,11H,3-5,7-10H2,1-2H3,(H,15,18) |
| InChIKey | IBRLOAKJUJPSDW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|