C15H23N3O4S2 — CID 32626260
N-[2-(2-methylpropanoylamino)ethyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide (PubChem CID 32626260) has the molecular formula C15H23N3O4S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[2-(2-methylpropanoylamino)ethyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-[2-(2-methylpropanoylamino)ethyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 32626260 |
| Molecular Formula | C15H23N3O4S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[2-(2-methylpropanoylamino)ethyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide |
| SMILES | CC(C)C(=O)NCCNC(=O)c1sccc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C15H23N3O4S2/c1-11(2)14(19)16-6-7-17-15(20)13-12(5-10-23-13)24(21,22)18-8-3-4-9-18/h5,10-11H,3-4,6-9H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | FRCVBDHHMKCYKL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|