C19H32N4O3S2 — CID 78871188
N-[4-(4-ethylpiperazin-1-yl)butyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide (PubChem CID 78871188) has the molecular formula C19H32N4O3S2 and a molecular weight of 428.62 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)butyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)butyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 78871188 |
| Molecular Formula | C19H32N4O3S2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)butyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide |
| SMILES | CCN1CCN(CCCCNC(=O)c2sccc2S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C19H32N4O3S2/c1-2-21-12-14-22(15-13-21)9-4-3-8-20-19(24)18-17(7-16-27-18)28(25,26)23-10-5-6-11-23/h7,16H,2-6,8-15H2,1H3,(H,20,24) |
| InChIKey | PKDORJFYIPEAAW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|