C14H25ClN4O3S2 — CID 119392093
3-(dimethylsulfamoyl)-N-(3-piperazin-1-ylpropyl)thiophene-2-carboxamide;hydrochloride (PubChem CID 119392093) has the molecular formula C14H25ClN4O3S2 and a molecular weight of 396.97 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-(3-piperazin-1-ylpropyl)thiophene-2-carboxamide;hydrochloride.
| Compound Name | 3-(dimethylsulfamoyl)-N-(3-piperazin-1-ylpropyl)thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119392093 |
| Molecular Formula | C14H25ClN4O3S2 |
| Molecular Weight | 396.97 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-(3-piperazin-1-ylpropyl)thiophene-2-carboxamide;hydrochloride |
| SMILES | CN(C)S(=O)(=O)c1ccsc1C(=O)NCCCN1CCNCC1.Cl |
| InChI | InChI=1S/C14H24N4O3S2.ClH/c1-17(2)23(20,21)12-4-11-22-13(12)14(19)16-5-3-8-18-9-6-15-7-10-18;/h4,11,15H,3,5-10H2,1-2H3,(H,16,19);1H |
| InChIKey | OVMYEZLDMRRGOK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.97 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|