C12H20ClN3O2S — CID 119445747
3-methoxy-N-(2-piperazin-1-ylethyl)thiophene-2-carboxamide;hydrochloride (PubChem CID 119445747) has the molecular formula C12H20ClN3O2S and a molecular weight of 305.83 g/mol. Its IUPAC name is 3-methoxy-N-(2-piperazin-1-ylethyl)thiophene-2-carboxamide;hydrochloride.
| Compound Name | 3-methoxy-N-(2-piperazin-1-ylethyl)thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119445747 |
| Molecular Formula | C12H20ClN3O2S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 3-methoxy-N-(2-piperazin-1-ylethyl)thiophene-2-carboxamide;hydrochloride |
| SMILES | COc1ccsc1C(=O)NCCN1CCNCC1.Cl |
| InChI | InChI=1S/C12H19N3O2S.ClH/c1-17-10-2-9-18-11(10)12(16)14-5-8-15-6-3-13-4-7-15;/h2,9,13H,3-8H2,1H3,(H,14,16);1H |
| InChIKey | RCTHQBZQFHZMSF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |