C17H22N2O3S4 — CID 24566502
3-piperidin-1-ylsulfonyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]thiophene-2-carboxamide (PubChem CID 24566502) has the molecular formula C17H22N2O3S4 and a molecular weight of 430.64 g/mol. Its IUPAC name is 3-piperidin-1-ylsulfonyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]thiophene-2-carboxamide.
| Compound Name | 3-piperidin-1-ylsulfonyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24566502 |
| Molecular Formula | C17H22N2O3S4 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 3-piperidin-1-ylsulfonyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCSCc1cccs1)c1sccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H22N2O3S4/c20-17(18-7-12-23-13-14-5-4-10-24-14)16-15(6-11-25-16)26(21,22)19-8-2-1-3-9-19/h4-6,10-11H,1-3,7-9,12-13H2,(H,18,20) |
| InChIKey | KXKIDNWGUGTNSC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|