C21H28N2O3S3 — CID 46653457
1-(2,4-dimethylphenyl)sulfonyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]piperidine-4-carboxamide (PubChem CID 46653457) has the molecular formula C21H28N2O3S3 and a molecular weight of 452.67 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)sulfonyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,4-dimethylphenyl)sulfonyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46653457 |
| Molecular Formula | C21H28N2O3S3 |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 1-(2,4-dimethylphenyl)sulfonyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)NCCSCc3cccs3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H28N2O3S3/c1-16-5-6-20(17(2)14-16)29(25,26)23-10-7-18(8-11-23)21(24)22-9-13-27-15-19-4-3-12-28-19/h3-6,12,14,18H,7-11,13,15H2,1-2H3,(H,22,24) |
| InChIKey | HSYWZIQKPCPJKW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|